Files
cgrates/config/sessionscfg.go
2026-01-22 10:05:44 +01:00

844 lines
28 KiB
Go

/*
Real-time Online/Offline Charging System (OCS) for Telecom & ISP environments
Copyright (C) ITsysCOM GmbH
This program is free software: you can redistribute it and/or modify
it under the terms of the GNU Affero General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
This program is distributed in the hope that it will be useful,
but WITHOUT ANY WARRANTY; without even the implied warranty of
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
GNU Affero General Public License for more details.
You should have received a copy of the GNU Affero General Public License
along with this program. If not, see <https://www.gnu.org/licenses/>
*/
package config
import (
"fmt"
"slices"
"strconv"
"time"
"github.com/cgrates/cgrates/utils"
"github.com/cgrates/rpcclient"
)
// NewDfltFsConnConfig returns the first cached default value for a FreeSWITCHAgent connection
func NewDfltFsConnConfig() *FsConnCfg {
if dfltFsConnConfig == nil {
return new(FsConnCfg) // No defaults, most probably we are building the defaults now
}
dfltVal := *dfltFsConnConfig // Copy the value instead of it's pointer
return &dfltVal
}
// FsConnCfg one connection to FreeSWITCH server
type FsConnCfg struct {
Address string
Password string
Reconnects int
MaxReconnectInterval time.Duration
ReplyTimeout time.Duration
Alias string
}
func (fs *FsConnCfg) loadFromJSONCfg(jsnCfg *FsConnJsonCfg) (err error) {
if jsnCfg == nil {
return
}
if jsnCfg.Address != nil {
fs.Address = *jsnCfg.Address
}
if jsnCfg.Password != nil {
fs.Password = *jsnCfg.Password
}
if jsnCfg.Reconnects != nil {
fs.Reconnects = *jsnCfg.Reconnects
}
if jsnCfg.MaxReconnectInterval != nil {
if fs.MaxReconnectInterval, err = utils.ParseDurationWithNanosecs(*jsnCfg.MaxReconnectInterval); err != nil {
return
}
}
if jsnCfg.ReplyTimeout != nil {
if fs.ReplyTimeout, err = utils.ParseDurationWithNanosecs(*jsnCfg.ReplyTimeout); err != nil {
return
}
}
fs.Alias = fs.Address
if jsnCfg.Alias != nil && *jsnCfg.Alias != "" {
fs.Alias = *jsnCfg.Alias
}
return
}
// AsMapInterface returns the config as a map[string]any
func (fs *FsConnCfg) AsMapInterface() map[string]any {
return map[string]any{
utils.AddressCfg: fs.Address,
utils.Password: fs.Password,
utils.ReconnectsCfg: fs.Reconnects,
utils.MaxReconnectIntervalCfg: fs.MaxReconnectInterval.String(),
utils.ReplyTimeoutCfg: fs.ReplyTimeout.String(),
utils.AliasCfg: fs.Alias,
}
}
// Clone returns a deep copy of FsConnCfg
func (fs FsConnCfg) Clone() *FsConnCfg {
return &FsConnCfg{
Address: fs.Address,
Password: fs.Password,
Reconnects: fs.Reconnects,
MaxReconnectInterval: fs.MaxReconnectInterval,
ReplyTimeout: fs.ReplyTimeout,
Alias: fs.Alias,
}
}
// SessionSCfg is the config section for SessionS
type SessionSCfg struct {
Enabled bool
ListenBiJSON string
ListenBiGob string
ChargerSConns []string
RALsConns []string
IPsConns []string
ResourceSConns []string
ThresholdSConns []string
StatSConns []string
RouteSConns []string
AttributeSConns []string
CDRsConns []string
ReplicationConns []string
DebitInterval time.Duration
StoreSCosts bool
SessionTTL time.Duration
SessionTTLMaxDelay *time.Duration
SessionTTLLastUsed *time.Duration
SessionTTLUsage *time.Duration
SessionTTLLastUsage *time.Duration
SessionIndexes utils.StringSet
ClientProtocol float64
ChannelSyncInterval time.Duration
StaleChanMaxExtraUsage time.Duration
TerminateAttempts int
AlterableFields utils.StringSet
MinDurLowBalance time.Duration
SchedulerConns []string
STIRCfg *STIRcfg
DefaultUsage map[string]time.Duration
BackupInterval time.Duration
}
func (scfg *SessionSCfg) loadFromJSONCfg(jsnCfg *SessionSJsonCfg) (err error) {
if jsnCfg == nil {
return nil
}
if jsnCfg.Enabled != nil {
scfg.Enabled = *jsnCfg.Enabled
}
if jsnCfg.ListenBiJSON != nil {
scfg.ListenBiJSON = *jsnCfg.ListenBiJSON
}
if jsnCfg.ListenBiGob != nil {
scfg.ListenBiGob = *jsnCfg.ListenBiGob
}
if jsnCfg.ChargerSConns != nil {
scfg.ChargerSConns = make([]string, len(*jsnCfg.ChargerSConns))
for idx, connID := range *jsnCfg.ChargerSConns {
// if we have the connection internal we change the name so we can have internal rpc for each subsystem
scfg.ChargerSConns[idx] = connID
if connID == utils.MetaInternal {
scfg.ChargerSConns[idx] = utils.ConcatenatedKey(utils.MetaInternal, utils.MetaChargers)
}
}
}
if jsnCfg.RALsConns != nil {
scfg.RALsConns = make([]string, len(*jsnCfg.RALsConns))
for idx, connID := range *jsnCfg.RALsConns {
// if we have the connection internal we change the name so we can have internal rpc for each subsystem
scfg.RALsConns[idx] = connID
if connID == utils.MetaInternal {
scfg.RALsConns[idx] = utils.ConcatenatedKey(utils.MetaInternal, utils.MetaResponder)
}
}
}
if jsnCfg.IPsConns != nil {
scfg.IPsConns = tagInternalConns(*jsnCfg.IPsConns, utils.MetaIPs)
}
if jsnCfg.ResourceSConns != nil {
scfg.ResourceSConns = tagInternalConns(*jsnCfg.ResourceSConns, utils.MetaResources)
}
if jsnCfg.ThresholdSConns != nil {
scfg.ThresholdSConns = tagInternalConns(*jsnCfg.ThresholdSConns, utils.MetaThresholds)
}
if jsnCfg.StatSConns != nil {
scfg.StatSConns = tagInternalConns(*jsnCfg.StatSConns, utils.MetaStats)
}
if jsnCfg.RouteSConns != nil {
scfg.RouteSConns = tagInternalConns(*jsnCfg.RouteSConns, utils.MetaRoutes)
}
if jsnCfg.AttributeSConns != nil {
scfg.AttributeSConns = tagInternalConns(*jsnCfg.AttributeSConns, utils.MetaAttributes)
}
if jsnCfg.CDRsConns != nil {
scfg.CDRsConns = tagInternalConns(*jsnCfg.CDRsConns, utils.MetaCDRs)
}
if jsnCfg.ReplicationConns != nil {
scfg.ReplicationConns = make([]string, len(*jsnCfg.ReplicationConns))
for idx, connID := range *jsnCfg.ReplicationConns {
if connID == utils.MetaInternal {
return fmt.Errorf("Replication connection ID needs to be different than *internal")
}
scfg.ReplicationConns[idx] = connID
}
}
if jsnCfg.DebitInterval != nil {
if scfg.DebitInterval, err = utils.ParseDurationWithNanosecs(*jsnCfg.DebitInterval); err != nil {
return err
}
}
if jsnCfg.StoreSCosts != nil {
scfg.StoreSCosts = *jsnCfg.StoreSCosts
}
if jsnCfg.SessionTTL != nil {
if scfg.SessionTTL, err = utils.ParseDurationWithNanosecs(*jsnCfg.SessionTTL); err != nil {
return err
}
}
if jsnCfg.SessionTTLMaxDelay != nil {
var maxTTLDelay time.Duration
if maxTTLDelay, err = utils.ParseDurationWithNanosecs(*jsnCfg.SessionTTLMaxDelay); err != nil {
return err
}
scfg.SessionTTLMaxDelay = &maxTTLDelay
}
if jsnCfg.SessionTTLLastUsed != nil {
var sessionTTLLastUsed time.Duration
if sessionTTLLastUsed, err = utils.ParseDurationWithNanosecs(*jsnCfg.SessionTTLLastUsed); err != nil {
return err
}
scfg.SessionTTLLastUsed = &sessionTTLLastUsed
}
if jsnCfg.SessionTTLUsage != nil {
var sessionTTLUsage time.Duration
if sessionTTLUsage, err = utils.ParseDurationWithNanosecs(*jsnCfg.SessionTTLUsage); err != nil {
return err
}
scfg.SessionTTLUsage = &sessionTTLUsage
}
if jsnCfg.SessionTTLLastUsage != nil {
var sessionTTLLastUsage time.Duration
if sessionTTLLastUsage, err = utils.ParseDurationWithNanosecs(*jsnCfg.SessionTTLLastUsage); err != nil {
return err
}
scfg.SessionTTLLastUsage = &sessionTTLLastUsage
}
if jsnCfg.SessionIndexes != nil {
scfg.SessionIndexes = utils.NewStringSet(*jsnCfg.SessionIndexes)
}
if jsnCfg.ClientProtocol != nil {
scfg.ClientProtocol = *jsnCfg.ClientProtocol
}
if jsnCfg.ChannelSyncInterval != nil {
if scfg.ChannelSyncInterval, err = utils.ParseDurationWithNanosecs(*jsnCfg.ChannelSyncInterval); err != nil {
return err
}
}
if jsnCfg.StaleChanMaxExtraUsage != nil {
if scfg.StaleChanMaxExtraUsage, err = utils.ParseDurationWithNanosecs(*jsnCfg.StaleChanMaxExtraUsage); err != nil {
return err
}
}
if jsnCfg.TerminateAttempts != nil {
scfg.TerminateAttempts = *jsnCfg.TerminateAttempts
}
if jsnCfg.AlterableFields != nil {
scfg.AlterableFields = utils.NewStringSet(*jsnCfg.AlterableFields)
}
if jsnCfg.MinDurLowBalance != nil {
if scfg.MinDurLowBalance, err = utils.ParseDurationWithNanosecs(*jsnCfg.MinDurLowBalance); err != nil {
return err
}
}
if jsnCfg.DefaultUsage != nil {
for k, v := range *jsnCfg.DefaultUsage {
if scfg.DefaultUsage[k], err = utils.ParseDurationWithNanosecs(v); err != nil {
return
}
}
}
if jsnCfg.SchedulerConns != nil {
scfg.SchedulerConns = tagInternalConns(*jsnCfg.SchedulerConns, utils.MetaScheduler)
}
if jsnCfg.BackupInterval != nil {
if scfg.BackupInterval, err = utils.ParseDurationWithNanosecs(*jsnCfg.BackupInterval); err != nil {
return err
}
}
return scfg.STIRCfg.loadFromJSONCfg(jsnCfg.Stir)
}
func (scfg *SessionSCfg) GetDefaultUsage(tor string) time.Duration {
if tor == utils.EmptyString {
tor = utils.MetaAny
}
return scfg.DefaultUsage[tor]
}
// AsMapInterface returns the config as a map[string]any
func (scfg *SessionSCfg) AsMapInterface() (initialMP map[string]any) {
maxComputed := make(map[string]string)
for key, item := range scfg.DefaultUsage {
if key == utils.MetaAny || key == utils.MetaVoice {
maxComputed[key] = item.String()
} else {
maxComputed[key] = strconv.Itoa(int(item))
}
}
initialMP = map[string]any{
utils.EnabledCfg: scfg.Enabled,
utils.ListenBijsonCfg: scfg.ListenBiJSON,
utils.ListenBigobCfg: scfg.ListenBiGob,
utils.ChargerSConnsCfg: stripInternalConns(scfg.ChargerSConns),
utils.RALsConnsCfg: stripInternalConns(scfg.RALsConns),
utils.IPsConnsCfg: stripInternalConns(scfg.IPsConns),
utils.ResourceSConnsCfg: stripInternalConns(scfg.ResourceSConns),
utils.ThresholdSConnsCfg: stripInternalConns(scfg.ThresholdSConns),
utils.StatSConnsCfg: stripInternalConns(scfg.StatSConns),
utils.RouteSConnsCfg: stripInternalConns(scfg.RouteSConns),
utils.AttributeSConnsCfg: stripInternalConns(scfg.AttributeSConns),
utils.CDRsConnsCfg: stripInternalConns(scfg.CDRsConns),
utils.SchedulerConnsCfg: stripInternalConns(scfg.SchedulerConns),
utils.ReplicationConnsCfg: scfg.ReplicationConns,
utils.StoreSCostsCfg: scfg.StoreSCosts,
utils.SessionIndexesCfg: scfg.SessionIndexes.AsSlice(),
utils.ClientProtocolCfg: scfg.ClientProtocol,
utils.TerminateAttemptsCfg: scfg.TerminateAttempts,
utils.AlterableFieldsCfg: scfg.AlterableFields.AsSlice(),
utils.STIRCfg: scfg.STIRCfg.AsMapInterface(),
utils.MinDurLowBalanceCfg: "0",
utils.ChannelSyncIntervalCfg: "0",
utils.StaleChanMaxExtraUsageCfg: "0",
utils.DebitIntervalCfg: "0",
utils.SessionTTLCfg: "0",
utils.BackupIntervalCfg: "0",
utils.DefaultUsageCfg: maxComputed,
}
if scfg.DebitInterval != 0 {
initialMP[utils.DebitIntervalCfg] = scfg.DebitInterval.String()
}
if scfg.SessionTTL != 0 {
initialMP[utils.SessionTTLCfg] = scfg.SessionTTL.String()
}
if scfg.SessionTTLMaxDelay != nil {
initialMP[utils.SessionTTLMaxDelayCfg] = scfg.SessionTTLMaxDelay.String()
}
if scfg.SessionTTLLastUsed != nil {
initialMP[utils.SessionTTLLastUsedCfg] = scfg.SessionTTLLastUsed.String()
}
if scfg.SessionTTLUsage != nil {
initialMP[utils.SessionTTLUsageCfg] = scfg.SessionTTLUsage.String()
}
if scfg.SessionTTLLastUsage != nil {
initialMP[utils.SessionTTLLastUsageCfg] = scfg.SessionTTLLastUsage.String()
}
if scfg.ChannelSyncInterval != 0 {
initialMP[utils.ChannelSyncIntervalCfg] = scfg.ChannelSyncInterval.String()
}
if scfg.StaleChanMaxExtraUsage != 0 {
initialMP[utils.StaleChanMaxExtraUsageCfg] = scfg.StaleChanMaxExtraUsage.String()
}
if scfg.MinDurLowBalance != 0 {
initialMP[utils.MinDurLowBalanceCfg] = scfg.MinDurLowBalance.String()
}
if scfg.BackupInterval != 0 {
initialMP[utils.BackupIntervalCfg] = scfg.BackupInterval.String()
}
return
}
// Clone returns a deep copy of SessionSCfg
func (scfg SessionSCfg) Clone() (cln *SessionSCfg) {
cln = &SessionSCfg{
Enabled: scfg.Enabled,
ListenBiJSON: scfg.ListenBiJSON,
IPsConns: slices.Clone(scfg.IPsConns),
DebitInterval: scfg.DebitInterval,
StoreSCosts: scfg.StoreSCosts,
SessionTTL: scfg.SessionTTL,
BackupInterval: scfg.BackupInterval,
ClientProtocol: scfg.ClientProtocol,
ChannelSyncInterval: scfg.ChannelSyncInterval,
StaleChanMaxExtraUsage: scfg.StaleChanMaxExtraUsage,
TerminateAttempts: scfg.TerminateAttempts,
MinDurLowBalance: scfg.MinDurLowBalance,
SessionIndexes: scfg.SessionIndexes.Clone(),
AlterableFields: scfg.AlterableFields.Clone(),
STIRCfg: scfg.STIRCfg.Clone(),
DefaultUsage: make(map[string]time.Duration),
}
for k, v := range scfg.DefaultUsage {
cln.DefaultUsage[k] = v
}
if scfg.SessionTTLMaxDelay != nil {
cln.SessionTTLMaxDelay = new(time.Duration)
*cln.SessionTTLMaxDelay = *scfg.SessionTTLMaxDelay
}
if scfg.SessionTTLLastUsed != nil {
cln.SessionTTLLastUsed = new(time.Duration)
*cln.SessionTTLLastUsed = *scfg.SessionTTLLastUsed
}
if scfg.SessionTTLUsage != nil {
cln.SessionTTLUsage = new(time.Duration)
*cln.SessionTTLUsage = *scfg.SessionTTLUsage
}
if scfg.SessionTTLLastUsage != nil {
cln.SessionTTLLastUsage = new(time.Duration)
*cln.SessionTTLLastUsage = *scfg.SessionTTLLastUsage
}
if scfg.ChargerSConns != nil {
cln.ChargerSConns = make([]string, len(scfg.ChargerSConns))
copy(cln.ChargerSConns, scfg.ChargerSConns)
}
if scfg.RALsConns != nil {
cln.RALsConns = make([]string, len(scfg.RALsConns))
copy(cln.RALsConns, scfg.RALsConns)
}
if scfg.ResourceSConns != nil {
cln.ResourceSConns = make([]string, len(scfg.ResourceSConns))
copy(cln.ResourceSConns, scfg.ResourceSConns)
}
if scfg.ThresholdSConns != nil {
cln.ThresholdSConns = make([]string, len(scfg.ThresholdSConns))
copy(cln.ThresholdSConns, scfg.ThresholdSConns)
}
if scfg.StatSConns != nil {
cln.StatSConns = make([]string, len(scfg.StatSConns))
copy(cln.StatSConns, scfg.StatSConns)
}
if scfg.RouteSConns != nil {
cln.RouteSConns = make([]string, len(scfg.RouteSConns))
copy(cln.RouteSConns, scfg.RouteSConns)
}
if scfg.AttributeSConns != nil {
cln.AttributeSConns = make([]string, len(scfg.AttributeSConns))
copy(cln.AttributeSConns, scfg.AttributeSConns)
}
if scfg.CDRsConns != nil {
cln.CDRsConns = make([]string, len(scfg.CDRsConns))
copy(cln.CDRsConns, scfg.CDRsConns)
}
if scfg.ReplicationConns != nil {
cln.ReplicationConns = make([]string, len(scfg.ReplicationConns))
copy(cln.ReplicationConns, scfg.ReplicationConns)
}
if scfg.SchedulerConns != nil {
cln.SchedulerConns = make([]string, len(scfg.SchedulerConns))
copy(cln.SchedulerConns, scfg.SchedulerConns)
}
return
}
// FsAgentCfg the config section that describes the FreeSWITCH Agent
type FsAgentCfg struct {
Enabled bool
SessionSConns []string
SubscribePark bool
CreateCDR bool
ExtraFields RSRParsers
LowBalanceAnnFile string
EmptyBalanceContext string
EmptyBalanceAnnFile string
ActiveSessionDelimiter string
MaxWaitConnection time.Duration
RouteProfile bool
SchedTransferExtension string
EventSocketConns []*FsConnCfg
}
func (fscfg *FsAgentCfg) loadFromJSONCfg(jsnCfg *FreeswitchAgentJsonCfg) error {
if jsnCfg == nil {
return nil
}
var err error
if jsnCfg.Enabled != nil {
fscfg.Enabled = *jsnCfg.Enabled
}
if jsnCfg.SessionSConns != nil {
fscfg.SessionSConns = make([]string, len(*jsnCfg.SessionSConns))
for idx, connID := range *jsnCfg.SessionSConns {
// if we have the connection internal we change the name so we can have internal rpc for each subsystem
fscfg.SessionSConns[idx] = connID
if connID == utils.MetaInternal ||
connID == rpcclient.BiRPCInternal {
fscfg.SessionSConns[idx] = utils.ConcatenatedKey(connID, utils.MetaSessionS)
}
}
}
if jsnCfg.SubscribePark != nil {
fscfg.SubscribePark = *jsnCfg.SubscribePark
}
if jsnCfg.CreateCDR != nil {
fscfg.CreateCDR = *jsnCfg.CreateCDR
}
if jsnCfg.RouteProfile != nil {
fscfg.RouteProfile = *jsnCfg.RouteProfile
}
if jsnCfg.ExtraFields != nil {
if fscfg.ExtraFields, err = NewRSRParsersFromSlice(*jsnCfg.ExtraFields); err != nil {
return err
}
}
if jsnCfg.LowBalanceAnnFile != nil {
fscfg.LowBalanceAnnFile = *jsnCfg.LowBalanceAnnFile
}
if jsnCfg.EmptyBalanceContext != nil {
fscfg.EmptyBalanceContext = *jsnCfg.EmptyBalanceContext
}
if jsnCfg.EmptyBalanceAnnFile != nil {
fscfg.EmptyBalanceAnnFile = *jsnCfg.EmptyBalanceAnnFile
}
if jsnCfg.ActiveSessionDelimiter != nil {
fscfg.ActiveSessionDelimiter = *jsnCfg.ActiveSessionDelimiter
}
if jsnCfg.MaxWaitConnection != nil {
if fscfg.MaxWaitConnection, err = utils.ParseDurationWithNanosecs(*jsnCfg.MaxWaitConnection); err != nil {
return err
}
}
if jsnCfg.SchedTransferExtension != nil {
fscfg.SchedTransferExtension = *jsnCfg.SchedTransferExtension
}
if jsnCfg.EventSocketConns != nil {
fscfg.EventSocketConns = make([]*FsConnCfg, len(*jsnCfg.EventSocketConns))
for idx, jsnConnCfg := range *jsnCfg.EventSocketConns {
fscfg.EventSocketConns[idx] = NewDfltFsConnConfig()
fscfg.EventSocketConns[idx].loadFromJSONCfg(jsnConnCfg)
}
}
return nil
}
// AsMapInterface returns the config as a map[string]any
func (fscfg *FsAgentCfg) AsMapInterface(separator string) (initialMP map[string]any) {
initialMP = map[string]any{
utils.EnabledCfg: fscfg.Enabled,
utils.SubscribeParkCfg: fscfg.SubscribePark,
utils.CreateCdrCfg: fscfg.CreateCDR,
utils.RouteProfileCfg: fscfg.RouteProfile,
utils.LowBalanceAnnFileCfg: fscfg.LowBalanceAnnFile,
utils.EmptyBalanceContextCfg: fscfg.EmptyBalanceContext,
utils.EmptyBalanceAnnFileCfg: fscfg.EmptyBalanceAnnFile,
utils.ActiveSessionDelimiterCfg: fscfg.ActiveSessionDelimiter,
utils.SchedTransferExtensionCfg: fscfg.SchedTransferExtension,
}
if fscfg.SessionSConns != nil {
sessionSConns := make([]string, len(fscfg.SessionSConns))
for i, item := range fscfg.SessionSConns {
sessionSConns[i] = item
if item == utils.ConcatenatedKey(utils.MetaInternal, utils.MetaSessionS) {
sessionSConns[i] = utils.MetaInternal
} else if item == utils.ConcatenatedKey(rpcclient.BiRPCInternal, utils.MetaSessionS) {
sessionSConns[i] = rpcclient.BiRPCInternal
}
}
initialMP[utils.SessionSConnsCfg] = sessionSConns
}
if fscfg.ExtraFields != nil {
initialMP[utils.ExtraFieldsCfg] = fscfg.ExtraFields.GetRule(separator)
}
if fscfg.MaxWaitConnection != 0 {
initialMP[utils.MaxWaitConnectionCfg] = fscfg.MaxWaitConnection.String()
} else {
initialMP[utils.MaxWaitConnectionCfg] = utils.EmptyString
}
if fscfg.EventSocketConns != nil {
eventSocketConns := make([]map[string]any, len(fscfg.EventSocketConns))
for key, item := range fscfg.EventSocketConns {
eventSocketConns[key] = item.AsMapInterface()
}
initialMP[utils.EventSocketConnsCfg] = eventSocketConns
}
return
}
// Clone returns a deep copy of FsAgentCfg
func (fscfg FsAgentCfg) Clone() (cln *FsAgentCfg) {
cln = &FsAgentCfg{
Enabled: fscfg.Enabled,
SubscribePark: fscfg.SubscribePark,
CreateCDR: fscfg.CreateCDR,
RouteProfile: fscfg.RouteProfile,
ExtraFields: fscfg.ExtraFields.Clone(),
LowBalanceAnnFile: fscfg.LowBalanceAnnFile,
EmptyBalanceContext: fscfg.EmptyBalanceContext,
EmptyBalanceAnnFile: fscfg.EmptyBalanceAnnFile,
ActiveSessionDelimiter: fscfg.ActiveSessionDelimiter,
MaxWaitConnection: fscfg.MaxWaitConnection,
SchedTransferExtension: fscfg.SchedTransferExtension,
}
if fscfg.SessionSConns != nil {
cln.SessionSConns = make([]string, len(fscfg.SessionSConns))
copy(cln.SessionSConns, fscfg.SessionSConns)
}
if fscfg.EventSocketConns != nil {
cln.EventSocketConns = make([]*FsConnCfg, len(fscfg.EventSocketConns))
for i, req := range fscfg.EventSocketConns {
cln.EventSocketConns[i] = req.Clone()
}
}
return
}
// NewDefaultAsteriskConnCfg is uses stored defaults so we can pre-populate by loading from JSON config
func NewDefaultAsteriskConnCfg() *AsteriskConnCfg {
if dfltAstConnCfg == nil {
return new(AsteriskConnCfg) // No defaults, most probably we are building the defaults now
}
dfltVal := *dfltAstConnCfg // Copy the value instead of it's pointer
return &dfltVal
}
// AsteriskConnCfg the config for a Asterisk connection
type AsteriskConnCfg struct {
Alias string
Address string
User string
Password string
ConnectAttempts int
Reconnects int
AriWebSocket bool
MaxReconnectInterval time.Duration
}
func (aConnCfg *AsteriskConnCfg) loadFromJSONCfg(jsnCfg *AstConnJsonCfg) (err error) {
if jsnCfg == nil {
return
}
if jsnCfg.Address != nil {
aConnCfg.Address = *jsnCfg.Address
}
if jsnCfg.Alias != nil {
aConnCfg.Alias = *jsnCfg.Alias
}
if jsnCfg.User != nil {
aConnCfg.User = *jsnCfg.User
}
if jsnCfg.Password != nil {
aConnCfg.Password = *jsnCfg.Password
}
if jsnCfg.Connect_attempts != nil {
aConnCfg.ConnectAttempts = *jsnCfg.Connect_attempts
}
if jsnCfg.Reconnects != nil {
aConnCfg.Reconnects = *jsnCfg.Reconnects
}
if jsnCfg.Ari_websocket != nil {
aConnCfg.AriWebSocket = *jsnCfg.Ari_websocket
}
if jsnCfg.Max_reconnect_interval != nil {
if aConnCfg.MaxReconnectInterval, err = utils.ParseDurationWithNanosecs(*jsnCfg.Max_reconnect_interval); err != nil {
return
}
}
return
}
// AsMapInterface returns the config as a map[string]any
func (aConnCfg *AsteriskConnCfg) AsMapInterface() map[string]any {
return map[string]any{
utils.AliasCfg: aConnCfg.Alias,
utils.AddressCfg: aConnCfg.Address,
utils.UserCf: aConnCfg.User,
utils.Password: aConnCfg.Password,
utils.ConnectAttemptsCfg: aConnCfg.ConnectAttempts,
utils.ReconnectsCfg: aConnCfg.Reconnects,
utils.AriWebSocketCfg: aConnCfg.AriWebSocket,
utils.MaxReconnectIntervalCfg: aConnCfg.MaxReconnectInterval.String(),
}
}
// Clone returns a deep copy of AsteriskConnCfg
func (aConnCfg AsteriskConnCfg) Clone() *AsteriskConnCfg {
return &AsteriskConnCfg{
Alias: aConnCfg.Alias,
Address: aConnCfg.Address,
User: aConnCfg.User,
Password: aConnCfg.Password,
ConnectAttempts: aConnCfg.ConnectAttempts,
Reconnects: aConnCfg.Reconnects,
AriWebSocket: aConnCfg.AriWebSocket,
MaxReconnectInterval: aConnCfg.MaxReconnectInterval,
}
}
// AsteriskAgentCfg the config section that describes the Asterisk Agent
type AsteriskAgentCfg struct {
Enabled bool
SessionSConns []string
CreateCDR bool
RouteProfile bool
AsteriskConns []*AsteriskConnCfg
}
func (aCfg *AsteriskAgentCfg) loadFromJSONCfg(jsnCfg *AsteriskAgentJsonCfg) (err error) {
if jsnCfg == nil {
return nil
}
if jsnCfg.Enabled != nil {
aCfg.Enabled = *jsnCfg.Enabled
}
if jsnCfg.Sessions_conns != nil {
aCfg.SessionSConns = make([]string, len(*jsnCfg.Sessions_conns))
for idx, attrConn := range *jsnCfg.Sessions_conns {
// if we have the connection internal we change the name so we can have internal rpc for each subsystem
aCfg.SessionSConns[idx] = attrConn
if attrConn == utils.MetaInternal ||
attrConn == rpcclient.BiRPCInternal {
aCfg.SessionSConns[idx] = utils.ConcatenatedKey(attrConn, utils.MetaSessionS)
}
}
}
if jsnCfg.Create_cdr != nil {
aCfg.CreateCDR = *jsnCfg.Create_cdr
}
if jsnCfg.Route_profile != nil {
aCfg.RouteProfile = *jsnCfg.Route_profile
}
if jsnCfg.Asterisk_conns != nil {
aCfg.AsteriskConns = make([]*AsteriskConnCfg, len(*jsnCfg.Asterisk_conns))
for i, jsnAConn := range *jsnCfg.Asterisk_conns {
aCfg.AsteriskConns[i] = NewDefaultAsteriskConnCfg()
aCfg.AsteriskConns[i].loadFromJSONCfg(jsnAConn)
}
}
return nil
}
// AsMapInterface returns the config as a map[string]any
func (aCfg *AsteriskAgentCfg) AsMapInterface() (initialMP map[string]any) {
initialMP = map[string]any{
utils.EnabledCfg: aCfg.Enabled,
utils.CreateCDRCfg: aCfg.CreateCDR,
utils.RouteProfileCfg: aCfg.RouteProfile,
}
if aCfg.AsteriskConns != nil {
conns := make([]map[string]any, len(aCfg.AsteriskConns))
for i, item := range aCfg.AsteriskConns {
conns[i] = item.AsMapInterface()
}
initialMP[utils.AsteriskConnsCfg] = conns
}
if aCfg.SessionSConns != nil {
sessionSConns := make([]string, len(aCfg.SessionSConns))
for i, item := range aCfg.SessionSConns {
sessionSConns[i] = item
if item == utils.ConcatenatedKey(utils.MetaInternal, utils.MetaSessionS) {
sessionSConns[i] = utils.MetaInternal
} else if item == utils.ConcatenatedKey(rpcclient.BiRPCInternal, utils.MetaSessionS) {
sessionSConns[i] = rpcclient.BiRPCInternal
}
}
initialMP[utils.SessionSConnsCfg] = sessionSConns
}
return
}
// Clone returns a deep copy of AsteriskAgentCfg
func (aCfg AsteriskAgentCfg) Clone() (cln *AsteriskAgentCfg) {
cln = &AsteriskAgentCfg{
Enabled: aCfg.Enabled,
CreateCDR: aCfg.CreateCDR,
RouteProfile: aCfg.RouteProfile,
}
if aCfg.SessionSConns != nil {
cln.SessionSConns = make([]string, len(aCfg.SessionSConns))
copy(cln.SessionSConns, aCfg.SessionSConns)
}
if aCfg.AsteriskConns != nil {
cln.AsteriskConns = make([]*AsteriskConnCfg, len(aCfg.AsteriskConns))
for i, req := range aCfg.AsteriskConns {
cln.AsteriskConns[i] = req.Clone()
}
}
return
}
// STIRcfg the confuguration structure for STIR
type STIRcfg struct {
AllowedAttest utils.StringSet
PayloadMaxduration time.Duration
DefaultAttest string
PublicKeyPath string
PrivateKeyPath string
}
func (stirCfg *STIRcfg) loadFromJSONCfg(jsnCfg *STIRJsonCfg) (err error) {
if jsnCfg == nil {
return nil
}
if jsnCfg.Allowed_attest != nil {
stirCfg.AllowedAttest = utils.NewStringSet(*jsnCfg.Allowed_attest)
}
if jsnCfg.Payload_maxduration != nil {
if stirCfg.PayloadMaxduration, err = utils.ParseDurationWithNanosecs(*jsnCfg.Payload_maxduration); err != nil {
return err
}
}
if jsnCfg.Default_attest != nil {
stirCfg.DefaultAttest = *jsnCfg.Default_attest
}
if jsnCfg.Publickey_path != nil {
stirCfg.PublicKeyPath = *jsnCfg.Publickey_path
}
if jsnCfg.Privatekey_path != nil {
stirCfg.PrivateKeyPath = *jsnCfg.Privatekey_path
}
return nil
}
// AsMapInterface returns the config as a map[string]any
func (stirCfg *STIRcfg) AsMapInterface() (initialMP map[string]any) {
initialMP = map[string]any{
utils.DefaultAttestCfg: stirCfg.DefaultAttest,
utils.PublicKeyPathCfg: stirCfg.PublicKeyPath,
utils.PrivateKeyPathCfg: stirCfg.PrivateKeyPath,
utils.AllowedAtestCfg: stirCfg.AllowedAttest.AsSlice(),
utils.PayloadMaxdurationCfg: "0",
}
if stirCfg.PayloadMaxduration > 0 {
initialMP[utils.PayloadMaxdurationCfg] = stirCfg.PayloadMaxduration.String()
} else if stirCfg.PayloadMaxduration < 0 {
initialMP[utils.PayloadMaxdurationCfg] = "-1"
}
return
}
// Clone returns a deep copy of STIRcfg
func (stirCfg STIRcfg) Clone() *STIRcfg {
return &STIRcfg{
AllowedAttest: stirCfg.AllowedAttest.Clone(),
PayloadMaxduration: stirCfg.PayloadMaxduration,
DefaultAttest: stirCfg.DefaultAttest,
PublicKeyPath: stirCfg.PublicKeyPath,
PrivateKeyPath: stirCfg.PrivateKeyPath,
}
}