mirror of
https://github.com/cgrates/cgrates.git
synced 2026-02-11 18:16:24 +05:00
844 lines
28 KiB
Go
844 lines
28 KiB
Go
/*
|
|
Real-time Online/Offline Charging System (OCS) for Telecom & ISP environments
|
|
Copyright (C) ITsysCOM GmbH
|
|
|
|
This program is free software: you can redistribute it and/or modify
|
|
it under the terms of the GNU Affero General Public License as published by
|
|
the Free Software Foundation, either version 3 of the License, or
|
|
(at your option) any later version.
|
|
|
|
This program is distributed in the hope that it will be useful,
|
|
but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
|
GNU Affero General Public License for more details.
|
|
|
|
You should have received a copy of the GNU Affero General Public License
|
|
along with this program. If not, see <https://www.gnu.org/licenses/>
|
|
*/
|
|
|
|
package config
|
|
|
|
import (
|
|
"fmt"
|
|
"slices"
|
|
"strconv"
|
|
"time"
|
|
|
|
"github.com/cgrates/cgrates/utils"
|
|
"github.com/cgrates/rpcclient"
|
|
)
|
|
|
|
// NewDfltFsConnConfig returns the first cached default value for a FreeSWITCHAgent connection
|
|
func NewDfltFsConnConfig() *FsConnCfg {
|
|
if dfltFsConnConfig == nil {
|
|
return new(FsConnCfg) // No defaults, most probably we are building the defaults now
|
|
}
|
|
dfltVal := *dfltFsConnConfig // Copy the value instead of it's pointer
|
|
return &dfltVal
|
|
}
|
|
|
|
// FsConnCfg one connection to FreeSWITCH server
|
|
type FsConnCfg struct {
|
|
Address string
|
|
Password string
|
|
Reconnects int
|
|
MaxReconnectInterval time.Duration
|
|
ReplyTimeout time.Duration
|
|
Alias string
|
|
}
|
|
|
|
func (fs *FsConnCfg) loadFromJSONCfg(jsnCfg *FsConnJsonCfg) (err error) {
|
|
if jsnCfg == nil {
|
|
return
|
|
}
|
|
if jsnCfg.Address != nil {
|
|
fs.Address = *jsnCfg.Address
|
|
}
|
|
if jsnCfg.Password != nil {
|
|
fs.Password = *jsnCfg.Password
|
|
}
|
|
if jsnCfg.Reconnects != nil {
|
|
fs.Reconnects = *jsnCfg.Reconnects
|
|
}
|
|
if jsnCfg.MaxReconnectInterval != nil {
|
|
if fs.MaxReconnectInterval, err = utils.ParseDurationWithNanosecs(*jsnCfg.MaxReconnectInterval); err != nil {
|
|
return
|
|
}
|
|
}
|
|
if jsnCfg.ReplyTimeout != nil {
|
|
if fs.ReplyTimeout, err = utils.ParseDurationWithNanosecs(*jsnCfg.ReplyTimeout); err != nil {
|
|
return
|
|
}
|
|
}
|
|
fs.Alias = fs.Address
|
|
if jsnCfg.Alias != nil && *jsnCfg.Alias != "" {
|
|
fs.Alias = *jsnCfg.Alias
|
|
}
|
|
|
|
return
|
|
}
|
|
|
|
// AsMapInterface returns the config as a map[string]any
|
|
func (fs *FsConnCfg) AsMapInterface() map[string]any {
|
|
return map[string]any{
|
|
utils.AddressCfg: fs.Address,
|
|
utils.Password: fs.Password,
|
|
utils.ReconnectsCfg: fs.Reconnects,
|
|
utils.MaxReconnectIntervalCfg: fs.MaxReconnectInterval.String(),
|
|
utils.ReplyTimeoutCfg: fs.ReplyTimeout.String(),
|
|
utils.AliasCfg: fs.Alias,
|
|
}
|
|
}
|
|
|
|
// Clone returns a deep copy of FsConnCfg
|
|
func (fs FsConnCfg) Clone() *FsConnCfg {
|
|
return &FsConnCfg{
|
|
Address: fs.Address,
|
|
Password: fs.Password,
|
|
Reconnects: fs.Reconnects,
|
|
MaxReconnectInterval: fs.MaxReconnectInterval,
|
|
ReplyTimeout: fs.ReplyTimeout,
|
|
Alias: fs.Alias,
|
|
}
|
|
}
|
|
|
|
// SessionSCfg is the config section for SessionS
|
|
type SessionSCfg struct {
|
|
Enabled bool
|
|
ListenBiJSON string
|
|
ListenBiGob string
|
|
ChargerSConns []string
|
|
RALsConns []string
|
|
IPsConns []string
|
|
ResourceSConns []string
|
|
ThresholdSConns []string
|
|
StatSConns []string
|
|
RouteSConns []string
|
|
AttributeSConns []string
|
|
CDRsConns []string
|
|
ReplicationConns []string
|
|
DebitInterval time.Duration
|
|
StoreSCosts bool
|
|
SessionTTL time.Duration
|
|
SessionTTLMaxDelay *time.Duration
|
|
SessionTTLLastUsed *time.Duration
|
|
SessionTTLUsage *time.Duration
|
|
SessionTTLLastUsage *time.Duration
|
|
SessionIndexes utils.StringSet
|
|
ClientProtocol float64
|
|
ChannelSyncInterval time.Duration
|
|
StaleChanMaxExtraUsage time.Duration
|
|
TerminateAttempts int
|
|
AlterableFields utils.StringSet
|
|
MinDurLowBalance time.Duration
|
|
SchedulerConns []string
|
|
STIRCfg *STIRcfg
|
|
DefaultUsage map[string]time.Duration
|
|
BackupInterval time.Duration
|
|
}
|
|
|
|
func (scfg *SessionSCfg) loadFromJSONCfg(jsnCfg *SessionSJsonCfg) (err error) {
|
|
if jsnCfg == nil {
|
|
return nil
|
|
}
|
|
if jsnCfg.Enabled != nil {
|
|
scfg.Enabled = *jsnCfg.Enabled
|
|
}
|
|
if jsnCfg.ListenBiJSON != nil {
|
|
scfg.ListenBiJSON = *jsnCfg.ListenBiJSON
|
|
}
|
|
if jsnCfg.ListenBiGob != nil {
|
|
scfg.ListenBiGob = *jsnCfg.ListenBiGob
|
|
}
|
|
if jsnCfg.ChargerSConns != nil {
|
|
scfg.ChargerSConns = make([]string, len(*jsnCfg.ChargerSConns))
|
|
for idx, connID := range *jsnCfg.ChargerSConns {
|
|
// if we have the connection internal we change the name so we can have internal rpc for each subsystem
|
|
scfg.ChargerSConns[idx] = connID
|
|
if connID == utils.MetaInternal {
|
|
scfg.ChargerSConns[idx] = utils.ConcatenatedKey(utils.MetaInternal, utils.MetaChargers)
|
|
}
|
|
}
|
|
}
|
|
if jsnCfg.RALsConns != nil {
|
|
scfg.RALsConns = make([]string, len(*jsnCfg.RALsConns))
|
|
for idx, connID := range *jsnCfg.RALsConns {
|
|
// if we have the connection internal we change the name so we can have internal rpc for each subsystem
|
|
scfg.RALsConns[idx] = connID
|
|
if connID == utils.MetaInternal {
|
|
scfg.RALsConns[idx] = utils.ConcatenatedKey(utils.MetaInternal, utils.MetaResponder)
|
|
}
|
|
}
|
|
}
|
|
if jsnCfg.IPsConns != nil {
|
|
scfg.IPsConns = tagInternalConns(*jsnCfg.IPsConns, utils.MetaIPs)
|
|
}
|
|
if jsnCfg.ResourceSConns != nil {
|
|
scfg.ResourceSConns = tagInternalConns(*jsnCfg.ResourceSConns, utils.MetaResources)
|
|
}
|
|
if jsnCfg.ThresholdSConns != nil {
|
|
scfg.ThresholdSConns = tagInternalConns(*jsnCfg.ThresholdSConns, utils.MetaThresholds)
|
|
}
|
|
if jsnCfg.StatSConns != nil {
|
|
scfg.StatSConns = tagInternalConns(*jsnCfg.StatSConns, utils.MetaStats)
|
|
}
|
|
if jsnCfg.RouteSConns != nil {
|
|
scfg.RouteSConns = tagInternalConns(*jsnCfg.RouteSConns, utils.MetaRoutes)
|
|
}
|
|
if jsnCfg.AttributeSConns != nil {
|
|
scfg.AttributeSConns = tagInternalConns(*jsnCfg.AttributeSConns, utils.MetaAttributes)
|
|
}
|
|
if jsnCfg.CDRsConns != nil {
|
|
scfg.CDRsConns = tagInternalConns(*jsnCfg.CDRsConns, utils.MetaCDRs)
|
|
}
|
|
if jsnCfg.ReplicationConns != nil {
|
|
scfg.ReplicationConns = make([]string, len(*jsnCfg.ReplicationConns))
|
|
for idx, connID := range *jsnCfg.ReplicationConns {
|
|
if connID == utils.MetaInternal {
|
|
return fmt.Errorf("Replication connection ID needs to be different than *internal")
|
|
}
|
|
scfg.ReplicationConns[idx] = connID
|
|
}
|
|
}
|
|
if jsnCfg.DebitInterval != nil {
|
|
if scfg.DebitInterval, err = utils.ParseDurationWithNanosecs(*jsnCfg.DebitInterval); err != nil {
|
|
return err
|
|
}
|
|
}
|
|
if jsnCfg.StoreSCosts != nil {
|
|
scfg.StoreSCosts = *jsnCfg.StoreSCosts
|
|
}
|
|
if jsnCfg.SessionTTL != nil {
|
|
if scfg.SessionTTL, err = utils.ParseDurationWithNanosecs(*jsnCfg.SessionTTL); err != nil {
|
|
return err
|
|
}
|
|
}
|
|
if jsnCfg.SessionTTLMaxDelay != nil {
|
|
var maxTTLDelay time.Duration
|
|
if maxTTLDelay, err = utils.ParseDurationWithNanosecs(*jsnCfg.SessionTTLMaxDelay); err != nil {
|
|
return err
|
|
}
|
|
scfg.SessionTTLMaxDelay = &maxTTLDelay
|
|
}
|
|
if jsnCfg.SessionTTLLastUsed != nil {
|
|
var sessionTTLLastUsed time.Duration
|
|
if sessionTTLLastUsed, err = utils.ParseDurationWithNanosecs(*jsnCfg.SessionTTLLastUsed); err != nil {
|
|
return err
|
|
}
|
|
scfg.SessionTTLLastUsed = &sessionTTLLastUsed
|
|
}
|
|
if jsnCfg.SessionTTLUsage != nil {
|
|
var sessionTTLUsage time.Duration
|
|
if sessionTTLUsage, err = utils.ParseDurationWithNanosecs(*jsnCfg.SessionTTLUsage); err != nil {
|
|
return err
|
|
}
|
|
scfg.SessionTTLUsage = &sessionTTLUsage
|
|
}
|
|
if jsnCfg.SessionTTLLastUsage != nil {
|
|
var sessionTTLLastUsage time.Duration
|
|
if sessionTTLLastUsage, err = utils.ParseDurationWithNanosecs(*jsnCfg.SessionTTLLastUsage); err != nil {
|
|
return err
|
|
}
|
|
scfg.SessionTTLLastUsage = &sessionTTLLastUsage
|
|
}
|
|
if jsnCfg.SessionIndexes != nil {
|
|
scfg.SessionIndexes = utils.NewStringSet(*jsnCfg.SessionIndexes)
|
|
}
|
|
if jsnCfg.ClientProtocol != nil {
|
|
scfg.ClientProtocol = *jsnCfg.ClientProtocol
|
|
}
|
|
if jsnCfg.ChannelSyncInterval != nil {
|
|
if scfg.ChannelSyncInterval, err = utils.ParseDurationWithNanosecs(*jsnCfg.ChannelSyncInterval); err != nil {
|
|
return err
|
|
}
|
|
}
|
|
if jsnCfg.StaleChanMaxExtraUsage != nil {
|
|
if scfg.StaleChanMaxExtraUsage, err = utils.ParseDurationWithNanosecs(*jsnCfg.StaleChanMaxExtraUsage); err != nil {
|
|
return err
|
|
}
|
|
}
|
|
if jsnCfg.TerminateAttempts != nil {
|
|
scfg.TerminateAttempts = *jsnCfg.TerminateAttempts
|
|
}
|
|
if jsnCfg.AlterableFields != nil {
|
|
scfg.AlterableFields = utils.NewStringSet(*jsnCfg.AlterableFields)
|
|
}
|
|
if jsnCfg.MinDurLowBalance != nil {
|
|
if scfg.MinDurLowBalance, err = utils.ParseDurationWithNanosecs(*jsnCfg.MinDurLowBalance); err != nil {
|
|
return err
|
|
}
|
|
}
|
|
if jsnCfg.DefaultUsage != nil {
|
|
for k, v := range *jsnCfg.DefaultUsage {
|
|
if scfg.DefaultUsage[k], err = utils.ParseDurationWithNanosecs(v); err != nil {
|
|
return
|
|
}
|
|
}
|
|
}
|
|
if jsnCfg.SchedulerConns != nil {
|
|
scfg.SchedulerConns = tagInternalConns(*jsnCfg.SchedulerConns, utils.MetaScheduler)
|
|
}
|
|
if jsnCfg.BackupInterval != nil {
|
|
if scfg.BackupInterval, err = utils.ParseDurationWithNanosecs(*jsnCfg.BackupInterval); err != nil {
|
|
return err
|
|
}
|
|
}
|
|
return scfg.STIRCfg.loadFromJSONCfg(jsnCfg.Stir)
|
|
}
|
|
|
|
func (scfg *SessionSCfg) GetDefaultUsage(tor string) time.Duration {
|
|
if tor == utils.EmptyString {
|
|
tor = utils.MetaAny
|
|
}
|
|
return scfg.DefaultUsage[tor]
|
|
}
|
|
|
|
// AsMapInterface returns the config as a map[string]any
|
|
func (scfg *SessionSCfg) AsMapInterface() (initialMP map[string]any) {
|
|
maxComputed := make(map[string]string)
|
|
for key, item := range scfg.DefaultUsage {
|
|
if key == utils.MetaAny || key == utils.MetaVoice {
|
|
maxComputed[key] = item.String()
|
|
} else {
|
|
maxComputed[key] = strconv.Itoa(int(item))
|
|
}
|
|
}
|
|
initialMP = map[string]any{
|
|
utils.EnabledCfg: scfg.Enabled,
|
|
utils.ListenBijsonCfg: scfg.ListenBiJSON,
|
|
utils.ListenBigobCfg: scfg.ListenBiGob,
|
|
utils.ChargerSConnsCfg: stripInternalConns(scfg.ChargerSConns),
|
|
utils.RALsConnsCfg: stripInternalConns(scfg.RALsConns),
|
|
utils.IPsConnsCfg: stripInternalConns(scfg.IPsConns),
|
|
utils.ResourceSConnsCfg: stripInternalConns(scfg.ResourceSConns),
|
|
utils.ThresholdSConnsCfg: stripInternalConns(scfg.ThresholdSConns),
|
|
utils.StatSConnsCfg: stripInternalConns(scfg.StatSConns),
|
|
utils.RouteSConnsCfg: stripInternalConns(scfg.RouteSConns),
|
|
utils.AttributeSConnsCfg: stripInternalConns(scfg.AttributeSConns),
|
|
utils.CDRsConnsCfg: stripInternalConns(scfg.CDRsConns),
|
|
utils.SchedulerConnsCfg: stripInternalConns(scfg.SchedulerConns),
|
|
utils.ReplicationConnsCfg: scfg.ReplicationConns,
|
|
utils.StoreSCostsCfg: scfg.StoreSCosts,
|
|
utils.SessionIndexesCfg: scfg.SessionIndexes.AsSlice(),
|
|
utils.ClientProtocolCfg: scfg.ClientProtocol,
|
|
utils.TerminateAttemptsCfg: scfg.TerminateAttempts,
|
|
utils.AlterableFieldsCfg: scfg.AlterableFields.AsSlice(),
|
|
utils.STIRCfg: scfg.STIRCfg.AsMapInterface(),
|
|
utils.MinDurLowBalanceCfg: "0",
|
|
utils.ChannelSyncIntervalCfg: "0",
|
|
utils.StaleChanMaxExtraUsageCfg: "0",
|
|
utils.DebitIntervalCfg: "0",
|
|
utils.SessionTTLCfg: "0",
|
|
utils.BackupIntervalCfg: "0",
|
|
utils.DefaultUsageCfg: maxComputed,
|
|
}
|
|
if scfg.DebitInterval != 0 {
|
|
initialMP[utils.DebitIntervalCfg] = scfg.DebitInterval.String()
|
|
}
|
|
if scfg.SessionTTL != 0 {
|
|
initialMP[utils.SessionTTLCfg] = scfg.SessionTTL.String()
|
|
}
|
|
if scfg.SessionTTLMaxDelay != nil {
|
|
initialMP[utils.SessionTTLMaxDelayCfg] = scfg.SessionTTLMaxDelay.String()
|
|
}
|
|
if scfg.SessionTTLLastUsed != nil {
|
|
initialMP[utils.SessionTTLLastUsedCfg] = scfg.SessionTTLLastUsed.String()
|
|
}
|
|
if scfg.SessionTTLUsage != nil {
|
|
initialMP[utils.SessionTTLUsageCfg] = scfg.SessionTTLUsage.String()
|
|
}
|
|
if scfg.SessionTTLLastUsage != nil {
|
|
initialMP[utils.SessionTTLLastUsageCfg] = scfg.SessionTTLLastUsage.String()
|
|
}
|
|
if scfg.ChannelSyncInterval != 0 {
|
|
initialMP[utils.ChannelSyncIntervalCfg] = scfg.ChannelSyncInterval.String()
|
|
}
|
|
if scfg.StaleChanMaxExtraUsage != 0 {
|
|
initialMP[utils.StaleChanMaxExtraUsageCfg] = scfg.StaleChanMaxExtraUsage.String()
|
|
}
|
|
if scfg.MinDurLowBalance != 0 {
|
|
initialMP[utils.MinDurLowBalanceCfg] = scfg.MinDurLowBalance.String()
|
|
}
|
|
|
|
if scfg.BackupInterval != 0 {
|
|
initialMP[utils.BackupIntervalCfg] = scfg.BackupInterval.String()
|
|
}
|
|
return
|
|
}
|
|
|
|
// Clone returns a deep copy of SessionSCfg
|
|
func (scfg SessionSCfg) Clone() (cln *SessionSCfg) {
|
|
cln = &SessionSCfg{
|
|
Enabled: scfg.Enabled,
|
|
ListenBiJSON: scfg.ListenBiJSON,
|
|
IPsConns: slices.Clone(scfg.IPsConns),
|
|
DebitInterval: scfg.DebitInterval,
|
|
StoreSCosts: scfg.StoreSCosts,
|
|
SessionTTL: scfg.SessionTTL,
|
|
BackupInterval: scfg.BackupInterval,
|
|
ClientProtocol: scfg.ClientProtocol,
|
|
ChannelSyncInterval: scfg.ChannelSyncInterval,
|
|
StaleChanMaxExtraUsage: scfg.StaleChanMaxExtraUsage,
|
|
TerminateAttempts: scfg.TerminateAttempts,
|
|
MinDurLowBalance: scfg.MinDurLowBalance,
|
|
|
|
SessionIndexes: scfg.SessionIndexes.Clone(),
|
|
AlterableFields: scfg.AlterableFields.Clone(),
|
|
STIRCfg: scfg.STIRCfg.Clone(),
|
|
DefaultUsage: make(map[string]time.Duration),
|
|
}
|
|
for k, v := range scfg.DefaultUsage {
|
|
cln.DefaultUsage[k] = v
|
|
}
|
|
if scfg.SessionTTLMaxDelay != nil {
|
|
cln.SessionTTLMaxDelay = new(time.Duration)
|
|
*cln.SessionTTLMaxDelay = *scfg.SessionTTLMaxDelay
|
|
}
|
|
if scfg.SessionTTLLastUsed != nil {
|
|
cln.SessionTTLLastUsed = new(time.Duration)
|
|
*cln.SessionTTLLastUsed = *scfg.SessionTTLLastUsed
|
|
}
|
|
if scfg.SessionTTLUsage != nil {
|
|
cln.SessionTTLUsage = new(time.Duration)
|
|
*cln.SessionTTLUsage = *scfg.SessionTTLUsage
|
|
}
|
|
if scfg.SessionTTLLastUsage != nil {
|
|
cln.SessionTTLLastUsage = new(time.Duration)
|
|
*cln.SessionTTLLastUsage = *scfg.SessionTTLLastUsage
|
|
}
|
|
|
|
if scfg.ChargerSConns != nil {
|
|
cln.ChargerSConns = make([]string, len(scfg.ChargerSConns))
|
|
copy(cln.ChargerSConns, scfg.ChargerSConns)
|
|
|
|
}
|
|
if scfg.RALsConns != nil {
|
|
cln.RALsConns = make([]string, len(scfg.RALsConns))
|
|
copy(cln.RALsConns, scfg.RALsConns)
|
|
}
|
|
if scfg.ResourceSConns != nil {
|
|
cln.ResourceSConns = make([]string, len(scfg.ResourceSConns))
|
|
copy(cln.ResourceSConns, scfg.ResourceSConns)
|
|
}
|
|
if scfg.ThresholdSConns != nil {
|
|
cln.ThresholdSConns = make([]string, len(scfg.ThresholdSConns))
|
|
copy(cln.ThresholdSConns, scfg.ThresholdSConns)
|
|
}
|
|
if scfg.StatSConns != nil {
|
|
cln.StatSConns = make([]string, len(scfg.StatSConns))
|
|
copy(cln.StatSConns, scfg.StatSConns)
|
|
}
|
|
if scfg.RouteSConns != nil {
|
|
cln.RouteSConns = make([]string, len(scfg.RouteSConns))
|
|
copy(cln.RouteSConns, scfg.RouteSConns)
|
|
}
|
|
if scfg.AttributeSConns != nil {
|
|
cln.AttributeSConns = make([]string, len(scfg.AttributeSConns))
|
|
copy(cln.AttributeSConns, scfg.AttributeSConns)
|
|
}
|
|
if scfg.CDRsConns != nil {
|
|
cln.CDRsConns = make([]string, len(scfg.CDRsConns))
|
|
copy(cln.CDRsConns, scfg.CDRsConns)
|
|
|
|
}
|
|
if scfg.ReplicationConns != nil {
|
|
cln.ReplicationConns = make([]string, len(scfg.ReplicationConns))
|
|
copy(cln.ReplicationConns, scfg.ReplicationConns)
|
|
}
|
|
if scfg.SchedulerConns != nil {
|
|
cln.SchedulerConns = make([]string, len(scfg.SchedulerConns))
|
|
copy(cln.SchedulerConns, scfg.SchedulerConns)
|
|
}
|
|
|
|
return
|
|
}
|
|
|
|
// FsAgentCfg the config section that describes the FreeSWITCH Agent
|
|
type FsAgentCfg struct {
|
|
Enabled bool
|
|
SessionSConns []string
|
|
SubscribePark bool
|
|
CreateCDR bool
|
|
ExtraFields RSRParsers
|
|
LowBalanceAnnFile string
|
|
EmptyBalanceContext string
|
|
EmptyBalanceAnnFile string
|
|
ActiveSessionDelimiter string
|
|
MaxWaitConnection time.Duration
|
|
RouteProfile bool
|
|
SchedTransferExtension string
|
|
EventSocketConns []*FsConnCfg
|
|
}
|
|
|
|
func (fscfg *FsAgentCfg) loadFromJSONCfg(jsnCfg *FreeswitchAgentJsonCfg) error {
|
|
if jsnCfg == nil {
|
|
return nil
|
|
}
|
|
var err error
|
|
if jsnCfg.Enabled != nil {
|
|
fscfg.Enabled = *jsnCfg.Enabled
|
|
}
|
|
if jsnCfg.SessionSConns != nil {
|
|
fscfg.SessionSConns = make([]string, len(*jsnCfg.SessionSConns))
|
|
for idx, connID := range *jsnCfg.SessionSConns {
|
|
// if we have the connection internal we change the name so we can have internal rpc for each subsystem
|
|
fscfg.SessionSConns[idx] = connID
|
|
if connID == utils.MetaInternal ||
|
|
connID == rpcclient.BiRPCInternal {
|
|
fscfg.SessionSConns[idx] = utils.ConcatenatedKey(connID, utils.MetaSessionS)
|
|
}
|
|
}
|
|
}
|
|
if jsnCfg.SubscribePark != nil {
|
|
fscfg.SubscribePark = *jsnCfg.SubscribePark
|
|
}
|
|
if jsnCfg.CreateCDR != nil {
|
|
fscfg.CreateCDR = *jsnCfg.CreateCDR
|
|
}
|
|
if jsnCfg.RouteProfile != nil {
|
|
fscfg.RouteProfile = *jsnCfg.RouteProfile
|
|
}
|
|
if jsnCfg.ExtraFields != nil {
|
|
if fscfg.ExtraFields, err = NewRSRParsersFromSlice(*jsnCfg.ExtraFields); err != nil {
|
|
return err
|
|
}
|
|
}
|
|
if jsnCfg.LowBalanceAnnFile != nil {
|
|
fscfg.LowBalanceAnnFile = *jsnCfg.LowBalanceAnnFile
|
|
}
|
|
if jsnCfg.EmptyBalanceContext != nil {
|
|
fscfg.EmptyBalanceContext = *jsnCfg.EmptyBalanceContext
|
|
}
|
|
|
|
if jsnCfg.EmptyBalanceAnnFile != nil {
|
|
fscfg.EmptyBalanceAnnFile = *jsnCfg.EmptyBalanceAnnFile
|
|
}
|
|
if jsnCfg.ActiveSessionDelimiter != nil {
|
|
fscfg.ActiveSessionDelimiter = *jsnCfg.ActiveSessionDelimiter
|
|
}
|
|
if jsnCfg.MaxWaitConnection != nil {
|
|
if fscfg.MaxWaitConnection, err = utils.ParseDurationWithNanosecs(*jsnCfg.MaxWaitConnection); err != nil {
|
|
return err
|
|
}
|
|
}
|
|
if jsnCfg.SchedTransferExtension != nil {
|
|
fscfg.SchedTransferExtension = *jsnCfg.SchedTransferExtension
|
|
}
|
|
if jsnCfg.EventSocketConns != nil {
|
|
fscfg.EventSocketConns = make([]*FsConnCfg, len(*jsnCfg.EventSocketConns))
|
|
for idx, jsnConnCfg := range *jsnCfg.EventSocketConns {
|
|
fscfg.EventSocketConns[idx] = NewDfltFsConnConfig()
|
|
fscfg.EventSocketConns[idx].loadFromJSONCfg(jsnConnCfg)
|
|
}
|
|
}
|
|
return nil
|
|
}
|
|
|
|
// AsMapInterface returns the config as a map[string]any
|
|
func (fscfg *FsAgentCfg) AsMapInterface(separator string) (initialMP map[string]any) {
|
|
initialMP = map[string]any{
|
|
utils.EnabledCfg: fscfg.Enabled,
|
|
utils.SubscribeParkCfg: fscfg.SubscribePark,
|
|
utils.CreateCdrCfg: fscfg.CreateCDR,
|
|
utils.RouteProfileCfg: fscfg.RouteProfile,
|
|
utils.LowBalanceAnnFileCfg: fscfg.LowBalanceAnnFile,
|
|
utils.EmptyBalanceContextCfg: fscfg.EmptyBalanceContext,
|
|
utils.EmptyBalanceAnnFileCfg: fscfg.EmptyBalanceAnnFile,
|
|
utils.ActiveSessionDelimiterCfg: fscfg.ActiveSessionDelimiter,
|
|
utils.SchedTransferExtensionCfg: fscfg.SchedTransferExtension,
|
|
}
|
|
if fscfg.SessionSConns != nil {
|
|
sessionSConns := make([]string, len(fscfg.SessionSConns))
|
|
for i, item := range fscfg.SessionSConns {
|
|
sessionSConns[i] = item
|
|
if item == utils.ConcatenatedKey(utils.MetaInternal, utils.MetaSessionS) {
|
|
sessionSConns[i] = utils.MetaInternal
|
|
} else if item == utils.ConcatenatedKey(rpcclient.BiRPCInternal, utils.MetaSessionS) {
|
|
sessionSConns[i] = rpcclient.BiRPCInternal
|
|
}
|
|
}
|
|
initialMP[utils.SessionSConnsCfg] = sessionSConns
|
|
}
|
|
if fscfg.ExtraFields != nil {
|
|
initialMP[utils.ExtraFieldsCfg] = fscfg.ExtraFields.GetRule(separator)
|
|
}
|
|
|
|
if fscfg.MaxWaitConnection != 0 {
|
|
initialMP[utils.MaxWaitConnectionCfg] = fscfg.MaxWaitConnection.String()
|
|
} else {
|
|
initialMP[utils.MaxWaitConnectionCfg] = utils.EmptyString
|
|
}
|
|
if fscfg.EventSocketConns != nil {
|
|
eventSocketConns := make([]map[string]any, len(fscfg.EventSocketConns))
|
|
for key, item := range fscfg.EventSocketConns {
|
|
eventSocketConns[key] = item.AsMapInterface()
|
|
}
|
|
initialMP[utils.EventSocketConnsCfg] = eventSocketConns
|
|
}
|
|
return
|
|
}
|
|
|
|
// Clone returns a deep copy of FsAgentCfg
|
|
func (fscfg FsAgentCfg) Clone() (cln *FsAgentCfg) {
|
|
cln = &FsAgentCfg{
|
|
Enabled: fscfg.Enabled,
|
|
SubscribePark: fscfg.SubscribePark,
|
|
CreateCDR: fscfg.CreateCDR,
|
|
RouteProfile: fscfg.RouteProfile,
|
|
ExtraFields: fscfg.ExtraFields.Clone(),
|
|
LowBalanceAnnFile: fscfg.LowBalanceAnnFile,
|
|
EmptyBalanceContext: fscfg.EmptyBalanceContext,
|
|
EmptyBalanceAnnFile: fscfg.EmptyBalanceAnnFile,
|
|
ActiveSessionDelimiter: fscfg.ActiveSessionDelimiter,
|
|
MaxWaitConnection: fscfg.MaxWaitConnection,
|
|
SchedTransferExtension: fscfg.SchedTransferExtension,
|
|
}
|
|
if fscfg.SessionSConns != nil {
|
|
cln.SessionSConns = make([]string, len(fscfg.SessionSConns))
|
|
copy(cln.SessionSConns, fscfg.SessionSConns)
|
|
}
|
|
if fscfg.EventSocketConns != nil {
|
|
cln.EventSocketConns = make([]*FsConnCfg, len(fscfg.EventSocketConns))
|
|
for i, req := range fscfg.EventSocketConns {
|
|
cln.EventSocketConns[i] = req.Clone()
|
|
}
|
|
}
|
|
return
|
|
}
|
|
|
|
// NewDefaultAsteriskConnCfg is uses stored defaults so we can pre-populate by loading from JSON config
|
|
func NewDefaultAsteriskConnCfg() *AsteriskConnCfg {
|
|
if dfltAstConnCfg == nil {
|
|
return new(AsteriskConnCfg) // No defaults, most probably we are building the defaults now
|
|
}
|
|
dfltVal := *dfltAstConnCfg // Copy the value instead of it's pointer
|
|
return &dfltVal
|
|
}
|
|
|
|
// AsteriskConnCfg the config for a Asterisk connection
|
|
type AsteriskConnCfg struct {
|
|
Alias string
|
|
Address string
|
|
User string
|
|
Password string
|
|
ConnectAttempts int
|
|
Reconnects int
|
|
AriWebSocket bool
|
|
MaxReconnectInterval time.Duration
|
|
}
|
|
|
|
func (aConnCfg *AsteriskConnCfg) loadFromJSONCfg(jsnCfg *AstConnJsonCfg) (err error) {
|
|
if jsnCfg == nil {
|
|
return
|
|
}
|
|
if jsnCfg.Address != nil {
|
|
aConnCfg.Address = *jsnCfg.Address
|
|
}
|
|
if jsnCfg.Alias != nil {
|
|
aConnCfg.Alias = *jsnCfg.Alias
|
|
}
|
|
if jsnCfg.User != nil {
|
|
aConnCfg.User = *jsnCfg.User
|
|
}
|
|
if jsnCfg.Password != nil {
|
|
aConnCfg.Password = *jsnCfg.Password
|
|
}
|
|
if jsnCfg.Connect_attempts != nil {
|
|
aConnCfg.ConnectAttempts = *jsnCfg.Connect_attempts
|
|
}
|
|
if jsnCfg.Reconnects != nil {
|
|
aConnCfg.Reconnects = *jsnCfg.Reconnects
|
|
}
|
|
if jsnCfg.Ari_websocket != nil {
|
|
aConnCfg.AriWebSocket = *jsnCfg.Ari_websocket
|
|
}
|
|
if jsnCfg.Max_reconnect_interval != nil {
|
|
if aConnCfg.MaxReconnectInterval, err = utils.ParseDurationWithNanosecs(*jsnCfg.Max_reconnect_interval); err != nil {
|
|
return
|
|
}
|
|
}
|
|
return
|
|
}
|
|
|
|
// AsMapInterface returns the config as a map[string]any
|
|
func (aConnCfg *AsteriskConnCfg) AsMapInterface() map[string]any {
|
|
return map[string]any{
|
|
utils.AliasCfg: aConnCfg.Alias,
|
|
utils.AddressCfg: aConnCfg.Address,
|
|
utils.UserCf: aConnCfg.User,
|
|
utils.Password: aConnCfg.Password,
|
|
utils.ConnectAttemptsCfg: aConnCfg.ConnectAttempts,
|
|
utils.ReconnectsCfg: aConnCfg.Reconnects,
|
|
utils.AriWebSocketCfg: aConnCfg.AriWebSocket,
|
|
utils.MaxReconnectIntervalCfg: aConnCfg.MaxReconnectInterval.String(),
|
|
}
|
|
}
|
|
|
|
// Clone returns a deep copy of AsteriskConnCfg
|
|
func (aConnCfg AsteriskConnCfg) Clone() *AsteriskConnCfg {
|
|
return &AsteriskConnCfg{
|
|
Alias: aConnCfg.Alias,
|
|
Address: aConnCfg.Address,
|
|
User: aConnCfg.User,
|
|
Password: aConnCfg.Password,
|
|
ConnectAttempts: aConnCfg.ConnectAttempts,
|
|
Reconnects: aConnCfg.Reconnects,
|
|
AriWebSocket: aConnCfg.AriWebSocket,
|
|
MaxReconnectInterval: aConnCfg.MaxReconnectInterval,
|
|
}
|
|
}
|
|
|
|
// AsteriskAgentCfg the config section that describes the Asterisk Agent
|
|
type AsteriskAgentCfg struct {
|
|
Enabled bool
|
|
SessionSConns []string
|
|
CreateCDR bool
|
|
RouteProfile bool
|
|
AsteriskConns []*AsteriskConnCfg
|
|
}
|
|
|
|
func (aCfg *AsteriskAgentCfg) loadFromJSONCfg(jsnCfg *AsteriskAgentJsonCfg) (err error) {
|
|
if jsnCfg == nil {
|
|
return nil
|
|
}
|
|
if jsnCfg.Enabled != nil {
|
|
aCfg.Enabled = *jsnCfg.Enabled
|
|
}
|
|
if jsnCfg.Sessions_conns != nil {
|
|
aCfg.SessionSConns = make([]string, len(*jsnCfg.Sessions_conns))
|
|
for idx, attrConn := range *jsnCfg.Sessions_conns {
|
|
// if we have the connection internal we change the name so we can have internal rpc for each subsystem
|
|
aCfg.SessionSConns[idx] = attrConn
|
|
if attrConn == utils.MetaInternal ||
|
|
attrConn == rpcclient.BiRPCInternal {
|
|
aCfg.SessionSConns[idx] = utils.ConcatenatedKey(attrConn, utils.MetaSessionS)
|
|
}
|
|
}
|
|
}
|
|
if jsnCfg.Create_cdr != nil {
|
|
aCfg.CreateCDR = *jsnCfg.Create_cdr
|
|
}
|
|
if jsnCfg.Route_profile != nil {
|
|
aCfg.RouteProfile = *jsnCfg.Route_profile
|
|
}
|
|
|
|
if jsnCfg.Asterisk_conns != nil {
|
|
aCfg.AsteriskConns = make([]*AsteriskConnCfg, len(*jsnCfg.Asterisk_conns))
|
|
for i, jsnAConn := range *jsnCfg.Asterisk_conns {
|
|
aCfg.AsteriskConns[i] = NewDefaultAsteriskConnCfg()
|
|
aCfg.AsteriskConns[i].loadFromJSONCfg(jsnAConn)
|
|
}
|
|
}
|
|
return nil
|
|
}
|
|
|
|
// AsMapInterface returns the config as a map[string]any
|
|
func (aCfg *AsteriskAgentCfg) AsMapInterface() (initialMP map[string]any) {
|
|
initialMP = map[string]any{
|
|
utils.EnabledCfg: aCfg.Enabled,
|
|
utils.CreateCDRCfg: aCfg.CreateCDR,
|
|
utils.RouteProfileCfg: aCfg.RouteProfile,
|
|
}
|
|
if aCfg.AsteriskConns != nil {
|
|
conns := make([]map[string]any, len(aCfg.AsteriskConns))
|
|
for i, item := range aCfg.AsteriskConns {
|
|
conns[i] = item.AsMapInterface()
|
|
}
|
|
initialMP[utils.AsteriskConnsCfg] = conns
|
|
}
|
|
if aCfg.SessionSConns != nil {
|
|
sessionSConns := make([]string, len(aCfg.SessionSConns))
|
|
for i, item := range aCfg.SessionSConns {
|
|
sessionSConns[i] = item
|
|
if item == utils.ConcatenatedKey(utils.MetaInternal, utils.MetaSessionS) {
|
|
sessionSConns[i] = utils.MetaInternal
|
|
} else if item == utils.ConcatenatedKey(rpcclient.BiRPCInternal, utils.MetaSessionS) {
|
|
sessionSConns[i] = rpcclient.BiRPCInternal
|
|
}
|
|
}
|
|
initialMP[utils.SessionSConnsCfg] = sessionSConns
|
|
}
|
|
return
|
|
}
|
|
|
|
// Clone returns a deep copy of AsteriskAgentCfg
|
|
func (aCfg AsteriskAgentCfg) Clone() (cln *AsteriskAgentCfg) {
|
|
cln = &AsteriskAgentCfg{
|
|
Enabled: aCfg.Enabled,
|
|
CreateCDR: aCfg.CreateCDR,
|
|
RouteProfile: aCfg.RouteProfile,
|
|
}
|
|
if aCfg.SessionSConns != nil {
|
|
cln.SessionSConns = make([]string, len(aCfg.SessionSConns))
|
|
copy(cln.SessionSConns, aCfg.SessionSConns)
|
|
}
|
|
if aCfg.AsteriskConns != nil {
|
|
cln.AsteriskConns = make([]*AsteriskConnCfg, len(aCfg.AsteriskConns))
|
|
for i, req := range aCfg.AsteriskConns {
|
|
cln.AsteriskConns[i] = req.Clone()
|
|
}
|
|
}
|
|
return
|
|
}
|
|
|
|
// STIRcfg the confuguration structure for STIR
|
|
type STIRcfg struct {
|
|
AllowedAttest utils.StringSet
|
|
PayloadMaxduration time.Duration
|
|
DefaultAttest string
|
|
PublicKeyPath string
|
|
PrivateKeyPath string
|
|
}
|
|
|
|
func (stirCfg *STIRcfg) loadFromJSONCfg(jsnCfg *STIRJsonCfg) (err error) {
|
|
if jsnCfg == nil {
|
|
return nil
|
|
}
|
|
if jsnCfg.Allowed_attest != nil {
|
|
stirCfg.AllowedAttest = utils.NewStringSet(*jsnCfg.Allowed_attest)
|
|
}
|
|
if jsnCfg.Payload_maxduration != nil {
|
|
if stirCfg.PayloadMaxduration, err = utils.ParseDurationWithNanosecs(*jsnCfg.Payload_maxduration); err != nil {
|
|
return err
|
|
}
|
|
}
|
|
if jsnCfg.Default_attest != nil {
|
|
stirCfg.DefaultAttest = *jsnCfg.Default_attest
|
|
}
|
|
if jsnCfg.Publickey_path != nil {
|
|
stirCfg.PublicKeyPath = *jsnCfg.Publickey_path
|
|
}
|
|
if jsnCfg.Privatekey_path != nil {
|
|
stirCfg.PrivateKeyPath = *jsnCfg.Privatekey_path
|
|
}
|
|
return nil
|
|
}
|
|
|
|
// AsMapInterface returns the config as a map[string]any
|
|
func (stirCfg *STIRcfg) AsMapInterface() (initialMP map[string]any) {
|
|
initialMP = map[string]any{
|
|
utils.DefaultAttestCfg: stirCfg.DefaultAttest,
|
|
utils.PublicKeyPathCfg: stirCfg.PublicKeyPath,
|
|
utils.PrivateKeyPathCfg: stirCfg.PrivateKeyPath,
|
|
utils.AllowedAtestCfg: stirCfg.AllowedAttest.AsSlice(),
|
|
utils.PayloadMaxdurationCfg: "0",
|
|
}
|
|
if stirCfg.PayloadMaxduration > 0 {
|
|
initialMP[utils.PayloadMaxdurationCfg] = stirCfg.PayloadMaxduration.String()
|
|
} else if stirCfg.PayloadMaxduration < 0 {
|
|
initialMP[utils.PayloadMaxdurationCfg] = "-1"
|
|
}
|
|
return
|
|
}
|
|
|
|
// Clone returns a deep copy of STIRcfg
|
|
func (stirCfg STIRcfg) Clone() *STIRcfg {
|
|
return &STIRcfg{
|
|
AllowedAttest: stirCfg.AllowedAttest.Clone(),
|
|
PayloadMaxduration: stirCfg.PayloadMaxduration,
|
|
DefaultAttest: stirCfg.DefaultAttest,
|
|
PublicKeyPath: stirCfg.PublicKeyPath,
|
|
PrivateKeyPath: stirCfg.PrivateKeyPath,
|
|
}
|
|
}
|